Preferred Name |
ezetimibe |
|
Synonyms |
(3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one Zetia Ezedoc ezetimiba ezetimibum ezetimibe Ezetrol |
|
Definitions |
A beta-lactam that is azetidin-2-one which is substituted at 1, 3, and 4 by p-fluorophenyl, 3-(p-fluorophenyl)-3-hydroxypropyl, and 4-hydroxyphenyl groups, respectively (the 3R,3'S,4S enantiomer). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_49040 |
|
charge |
0 |
|
database_cross_reference |
CAS:163222-33-1 DrugBank:DB00973 PMID:17587760 Reaxys:7981967 Drug_Central:1125 Beilstein:7981967 PMID:23266293 LINCS:LSM-5536 PMID:23510093 PMID:18585981 PMID:23471229 PMID:23538020 HMDB:HMDB0015108 Wikipedia:Ezetimibe PMID:23219178 KEGG:D01966 PMID:23317398 |
|
definition |
A beta-lactam that is azetidin-2-one which is substituted at 1, 3, and 4 by p-fluorophenyl, 3-(p-fluorophenyl)-3-hydroxypropyl, and 4-hydroxyphenyl groups, respectively (the 3R,3'S,4S enantiomer). |
|
formula |
C24H21F2NO3 |
|
has exact synonym |
(3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
|
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Zetia Ezedoc ezetimiba ezetimibum ezetimibe Ezetrol |
|
id |
CHEBI:49040 |
|
in_subset | ||
inchi |
InChI=1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1 |
|
inchikey |
OLNTVTPDXPETLC-XPWALMASSA-N |
|
label |
ezetimibe |
|
mass |
409.42520 |
|
monoisotopicmass |
409.14895 |
|
notation |
CHEBI:49040 |
|
prefLabel |
ezetimibe |
|
smiles |
[H][C@]1(CC[C@H](O)c2ccc(F)cc2)C(=O)N(c2ccc(F)cc2)[C@]1([H])c1ccc(O)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 |