Preferred Name |
L-cystine |
|
Synonyms |
L-Cystine (2R,2'R)-3,3'-disulfanediylbis(2-aminopropanoic acid) L-cystine L-alpha-Diamino-beta-dithiolactic acid 3,3'-Dithiobis-L-alanine beta,beta'-diamino-beta,beta'-dicarboxydiethyl disulfide oxidized L-cysteine bis(beta-amino-beta-carboxyethyl) disulfide L-Dicysteine (R-(R*,R*))-3,3'-Dithiobis(2-aminopropanoic acid) (R,R)-3,3'-dithiobis(2-aminopropanoic acid) E921 beta,beta'-dithiodialanine |
|
Definitions |
The L-enantiomer of the sulfur-containing amino acid cystine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16283 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:1728094 CAS:56-89-3 HMDB:HMDB0000192 PMID:24327171 DrugBank:DB00138 KEGG:C00491 PMID:14726201 Drug_Central:4130 PMID:24264736 Beilstein:1728094 KNApSAcK:C00001352 Gmelin:397179 KEGG:D03636 |
|
definition |
The L-enantiomer of the sulfur-containing amino acid cystine. |
|
formula |
C6H12N2O4S2 |
|
has exact synonym |
L-Cystine (2R,2'R)-3,3'-disulfanediylbis(2-aminopropanoic acid) L-cystine |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_75772 |
|
has_alternative_id |
CHEBI:6209 CHEBI:21278 CHEBI:13097 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
L-alpha-Diamino-beta-dithiolactic acid 3,3'-Dithiobis-L-alanine beta,beta'-diamino-beta,beta'-dicarboxydiethyl disulfide oxidized L-cysteine bis(beta-amino-beta-carboxyethyl) disulfide L-Dicysteine (R-(R*,R*))-3,3'-Dithiobis(2-aminopropanoic acid) (R,R)-3,3'-dithiobis(2-aminopropanoic acid) E921 beta,beta'-dithiodialanine |
|
id |
CHEBI:16283 |
|
in_subset | ||
inchi |
InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
|
inchikey |
LEVWYRKDKASIDU-IMJSIDKUSA-N |
|
is conjugate acid of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-cystine |
|
mass |
240.30256 |
|
monoisotopicmass |
240.02385 |
|
notation |
CHEBI:16283 |
|
prefLabel |
L-cystine |
|
smiles |
N[C@@H](CSSC[C@H](N)C(O)=O)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83824 |