loading...| Preferred Name |
aztreonam |
|
| Synonyms |
(2S,3S)-3-{(2Z)-2-(2-ammonio-1,3-thiazol-4-yl)-2-[(2-carboxypropan-2-yloxy)imino]acetamido}-2-methyl-4-oxoazetidine-1-sulfonate AZT Azactam (Z,)-2-((((2-Amino-4-thiazolyl)(((2S,3S,)-2-methyl-4-oxo-1-sulfo-3-azetidinyl)carbamoyl)methylene)amino)oxy)-2-methylpropionic acid aztreonam aztreonamum Primbactam |
|
| Definitions |
A synthetic monocyclic beta-lactam antibiotic (monobactam), used primarily to treat infections caused by Gram-negative bacteria. It inhibits mucopeptide synthesis in the bacterial cell wall, thereby blocking peptidoglycan crosslinking. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_161680 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:25091537 Drug_Central:279 PMID:24119095 PMID:24176390 Wikipedia:Aztreonam PMID:1384868 PMID:28543395 DrugBank:DB00355 Reaxys:3577211 CAS:78110-38-0 KEGG:C06840 Beilstein:3577211 PMID:25049240 PMID:29017833 PMID:24369293 Patent:NL8100571 KEGG:D00240 PMID:15123864 PDBeChem:AZR PMID:25295210 |
|
| definition |
A synthetic monocyclic beta-lactam antibiotic (monobactam), used primarily to treat infections caused by Gram-negative bacteria. It inhibits mucopeptide synthesis in the bacterial cell wall, thereby blocking peptidoglycan crosslinking. |
|
| formula |
C13H17N5O8S2 |
|
| has exact synonym |
(2S,3S)-3-{(2Z)-2-(2-ammonio-1,3-thiazol-4-yl)-2-[(2-carboxypropan-2-yloxy)imino]acetamido}-2-methyl-4-oxoazetidine-1-sulfonate |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50696 |
|
| has_alternative_id |
CHEBI:41008 CHEBI:2960 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
AZT Azactam (Z,)-2-((((2-Amino-4-thiazolyl)(((2S,3S,)-2-methyl-4-oxo-1-sulfo-3-azetidinyl)carbamoyl)methylene)amino)oxy)-2-methylpropionic acid aztreonam aztreonamum Primbactam |
|
| id |
CHEBI:161680 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H17N5O8S2/c1-5-7(10(20)18(5)28(23,24)25)16-9(19)8(6-4-27-12(14)15-6)17-26-13(2,3)11(21)22/h4-5,7H,1-3H3,(H2,14,15)(H,16,19)(H,21,22)(H,23,24,25)/b17-8-/t5-,7-/m0/s1 |
|
| inchikey |
WZPBZJONDBGPKJ-VEHQQRBSSA-N |
|
| label |
aztreonam |
|
| mass |
435.43300 |
|
| monoisotopicmass |
435.05185 |
|
| notation |
CHEBI:161680 |
|
| prefixIRI |
CHEBI:161680 |
|
| prefLabel |
aztreonam |
|
| smiles |
C[C@H]1[C@H](NC(=O)C(=N/OC(C)(C)C(O)=O)\c2csc([NH3+])n2)C(=O)N1S([O-])(=O)=O |
|
| subClassOf |