Preferred Name |
pantothenic acid |
|
Synonyms |
Pantothenic acid 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoic acid 219.111 InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) CC(C)(CO)C(O)C(=O)NCCC(O)=O C9H17NO5 GHOKWGTUZJEAQD-UHFFFAOYSA-N N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alanine 219.23502 0 |
|
Definitions |
A member of the class of pantothenic acids that is an amide formed from pantoic acid and beta-alanine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7916 |
|
database_cross_reference |
colombos:PANTOTHENIC_ACID Reaxys:1727062 DrugBank:DB01783 CAS:599-54-2 Wikipedia:Pantothenic_acid HMDB:HMDB00210 Beilstein:1727062 KEGG:C00864 PMID:24727172 KEGG:D07413 |
|
has exact synonym |
Pantothenic acid 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoic acid |
|
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
219.111 InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) CC(C)(CO)C(O)C(=O)NCCC(O)=O C9H17NO5 GHOKWGTUZJEAQD-UHFFFAOYSA-N N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alanine 219.23502 0 |
|
id |
CHEBI:7916 |
|
in_subset | ||
is conjugate acid of | ||
label |
pantothenic acid |
|
notation |
CHEBI:7916 |
|
prefLabel |
pantothenic acid |
|
textual definition |
A member of the class of pantothenic acids that is an amide formed from pantoic acid and beta-alanine. |
|
subClassOf |