Jump to:
loading...| Preferred Name | 2-amino-3-hydroxybutanoic acid | |
| Synonyms |
CC(O)C(N)C(O)=O InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) AYFVYJQAPQTCCC-UHFFFAOYSA-N C4H9NO3 119.11920 119.058 0 2-amino-3-hydroxybutanoic acid |
|
| Definitions |
An alpha-amino acid that is butanoic acid substituted by an amino group at position 2 and a hydroxy group at position 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38263 |
|
| database_cross_reference |
Beilstein:1098902 |
|
| has exact synonym |
2-amino-3-hydroxybutanoic acid |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CC(O)C(N)C(O)=O InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) AYFVYJQAPQTCCC-UHFFFAOYSA-N C4H9NO3 119.11920 119.058 0 |
|
| id |
CHEBI:38263 |
|
| in_subset | ||
| label |
2-amino-3-hydroxybutanoic acid |
|
| notation |
CHEBI:38263 |
|
| prefLabel |
2-amino-3-hydroxybutanoic acid |
|
| textual definition |
An alpha-amino acid that is butanoic acid substituted by an amino group at position 2 and a hydroxy group at position 3. |
|
| subClassOf |
Create mapping