Preferred Name |
tryptophan |
|
Synonyms |
tryptophan Tryptophan W alpha-amino-beta-3-indolepropionic acid 2-amino-3-(1H-indol-3-yl)propanoic acid 204.22526 beta-3-indolylalanine InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) C11H12N2O2 triptofano alpha-Amino-beta-(3-indolyl)-propionic acid Trp NC(Cc1c[nH]c2ccccc12)C(O)=O Htrp tryptophane 0 204.090 QIVBCDIJIAJPQS-UHFFFAOYSA-N |
|
Definitions |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27897 |
|
database_cross_reference |
colombos:TRYPTOPHAN Wikipedia:Tryptophan CAS:54-12-6 PMID:22264337 PMID:17439666 LINCS:LSM-36836 Gmelin:4532 KEGG:C00806 Reaxys:86196 Beilstein:86196 KNApSAcK:C00001396 |
|
has exact synonym |
tryptophan Tryptophan |
|
has part | ||
has role | ||
has_alternative_id |
CHEBI:27163 CHEBI:9769 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
W alpha-amino-beta-3-indolepropionic acid 2-amino-3-(1H-indol-3-yl)propanoic acid 204.22526 beta-3-indolylalanine InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) C11H12N2O2 triptofano alpha-Amino-beta-(3-indolyl)-propionic acid Trp NC(Cc1c[nH]c2ccccc12)C(O)=O Htrp tryptophane 0 204.090 QIVBCDIJIAJPQS-UHFFFAOYSA-N |
|
id |
CHEBI:27897 |
|
in_subset | ||
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
tryptophan |
|
notation |
CHEBI:27897 |
|
prefLabel |
tryptophan |
|
textual definition |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33856 |