loading...| Preferred Name | leucine | |
| Synonyms |
Leuzin Hleu C6H13NO2 L 131.17296 ROHFNLRQFUQHCH-UHFFFAOYSA-N 131.095 (+-)-Leucine DL-Leucine InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) 0 (RS)-Leucine Leu CC(C)CC(N)C(O)=O 2-amino-4-methylpentanoic acid Leucin leucine |
|
| Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25017 |
|
| database_cross_reference |
colombos:LEUCINE PMID:17439666 KEGG:C16439 Gmelin:50203 CAS:328-39-2 Wikipedia:Leucine Beilstein:636005 Reaxys:636005 LIPID_MAPS_instance:LMFA01100048 |
|
| has biological role in Escherichia coli | ||
| has exact synonym |
leucine |
|
| has part | ||
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Leuzin Hleu C6H13NO2 L 131.17296 ROHFNLRQFUQHCH-UHFFFAOYSA-N 131.095 (+-)-Leucine DL-Leucine InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) 0 (RS)-Leucine Leu CC(C)CC(N)C(O)=O 2-amino-4-methylpentanoic acid Leucin |
|
| id |
CHEBI:25017 |
|
| in_subset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
leucine |
|
| notation |
CHEBI:25017 |
|
| prefLabel |
leucine |
|
| textual definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
|
| subClassOf |