Link to this page
Microbial Conditions Ontology
Last uploaded:
September 4, 2019
Jump to:
| Preferred Name | trimethylamine | |
| Synonyms |
N,N-Dimethylmethanamine CN(C)C NMe3 N,N,N-trimethylamine GETQZCLCWQTVFV-UHFFFAOYSA-N InChI=1S/C3H9N/c1-4(2)3/h1-3H3 59.11030 59.073 Trimethylamin TMA C3H9N 0 tridimethylaminomethane N(CH3)3 (CH3)3N Trimethylamine N,N-dimethylmethanamine |
|
| Definitions |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18139 |
|
| database_cross_reference |
HMDB:HMDB00906 KEGG:C00565 Reaxys:956566 CAS:75-50-3 KNApSAcK:C00001433 MetaCyc:TRIMETHYLAMINE PMID:15304308 PDBeChem:KEN PMID:15752091 PMID:1801314 PMID:2501587 PMID:17190852 PMID:14047118 Gmelin:1309 Wikipedia:Trimethylamine Beilstein:956566 PMID:5161463 PMID:24591617
|
|
| has exact synonym |
Trimethylamine N,N-dimethylmethanamine
|
|
| has role | ||
| has_alternative_id |
CHEBI:15261 CHEBI:9732 CHEBI:27125 CHEBI:27127
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
N,N-Dimethylmethanamine CN(C)C NMe3 N,N,N-trimethylamine GETQZCLCWQTVFV-UHFFFAOYSA-N InChI=1S/C3H9N/c1-4(2)3/h1-3H3 59.11030 59.073 Trimethylamin TMA C3H9N 0 tridimethylaminomethane N(CH3)3 (CH3)3N
|
|
| id |
CHEBI:18139
|
|
| in_subset | ||
| is conjugate base of | ||
| label |
trimethylamine
|
|
| notation |
CHEBI:18139
|
|
| prefLabel |
trimethylamine
|
|
| textual definition |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group.
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping