Jump to:
loading...| Preferred Name |
Prostaglandin E2 |
|
| Synonyms |
(5Z,13E,15S)-11alpha,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid |
|
| Definitions |
Prostaglandin F2alpha in which the hydroxy group at position 9 has been oxidised to the corresponding ketone. Prostaglandin E2 is the most common and most biologically potent of mammalian prostaglandins. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15551 |
|
| definition |
Prostaglandin F2alpha in which the hydroxy group at position 9 has been oxidised to the corresponding ketone. Prostaglandin E2 is the most common and most biologically potent of mammalian prostaglandins. |
|
| has_exact_synonym |
(5Z,13E,15S)-11alpha,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid |
|
| InChIKey |
XEYBRNLFEZDVAW-ARSRFYASSA-N |
|
| label |
Prostaglandin E2 |
|
| notation |
HOIP_0041673 |
|
| prefixIRI |
CHEBI:15551 |
|
| prefLabel |
Prostaglandin E2 |
|
| smiles |
CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O |
|
| subClassOf |
Create mapping