Preferred Name |
progesterone |
|
Synonyms |
pregn-4-ene-3,20-dione Progesterone PROGESTERONE Gelbkoerperhormon InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 Agolutin (S)-4-Pregnene-3,20-dione Crinone luteohormone [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O (S)-Pregn-4-en-3,20-dione Akrolutin Progesteron 4-Pregnene-3,20-dione InChIKey=RJKFOVLPORLFTN-LEKSSAKUSA-N (S)-Progesterone 17alpha-progesterone Delta(4)-pregnene-3,20-dione corpus luteum hormone C21H30O2 |
|
Definitions |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17026 |
|
database_cross_reference |
Wikipedia:Progesterone KEGG COMPOUND:57-83-0 KEGG COMPOUND:C00410 DrugBank:DB00396 Beilstein:1915950 PDBeChem:STR KEGG DRUG:D00066 NIST Chemistry WebBook:57-83-0 CiteXplore:9506942 Gmelin:708590 ChemIDplus:57-83-0 CiteXplore:10438974 |
|
definition |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
has_alternative_id |
CHEBI:8453 CHEBI:439 CHEBI:26269 CHEBI:14896 CHEBI:18798 CHEBI:45786 |
|
has_exact_synonym |
pregn-4-ene-3,20-dione Progesterone PROGESTERONE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Gelbkoerperhormon InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 Agolutin (S)-4-Pregnene-3,20-dione Crinone luteohormone [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O (S)-Pregn-4-en-3,20-dione Akrolutin Progesteron 4-Pregnene-3,20-dione InChIKey=RJKFOVLPORLFTN-LEKSSAKUSA-N (S)-Progesterone 17alpha-progesterone Delta(4)-pregnene-3,20-dione corpus luteum hormone C21H30O2 |
|
id |
CHEBI:17026 |
|
imported from | ||
label |
progesterone |
|
notation |
CHEBI:17026 |
|
prefixIRI |
CHEBI:17026 |
|
prefLabel |
progesterone |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 |