Preferred Name |
salicylic acid |
|
Synonyms |
Salicylic acid 2-hydroxybenzoic acid InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) o-carboxyphenol 2-HYDROXYBENZOIC ACID InChIKey=YGSDEFSMJLZEOE-UHFFFAOYSA-N C7H6O3 o-hydroxybenzoic acid 2-carboxyphenol OC(=O)c1ccccc1O o-Hydroxybenzoic acid |
|
Definitions |
ortho-Hydroxylated benzoic acid. It is obtained from the bark of the white willow and wintergreen leaves. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16914 |
|
database_cross_reference |
Gmelin:3418 KEGG DRUG:D00097 ChemIDplus:69-72-7 CiteXplore:3425858 KEGG COMPOUND:69-72-7 Wikipedia:Salicylic_Acid Reaxys:774890 KEGG COMPOUND:C00805 Beilstein:774890 MetaCyc:CPD-110 NIST Chemistry WebBook:69-72-7 DrugBank:DB00936 CiteXplore:22770225 CiteXplore:1650428 PDBeChem:SAL HMDB:HMDB01895 |
|
definition |
ortho-Hydroxylated benzoic acid. It is obtained from the bark of the white willow and wintergreen leaves. |
|
has_alternative_id |
CHEBI:45521 CHEBI:26597 CHEBI:9006 |
|
has_exact_synonym |
Salicylic acid 2-hydroxybenzoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) o-carboxyphenol 2-HYDROXYBENZOIC ACID InChIKey=YGSDEFSMJLZEOE-UHFFFAOYSA-N C7H6O3 o-hydroxybenzoic acid 2-carboxyphenol OC(=O)c1ccccc1O o-Hydroxybenzoic acid |
|
id |
CHEBI:16914 |
|
imported from | ||
label |
salicylic acid |
|
notation |
CHEBI:16914 |
|
prefixIRI |
CHEBI:16914 |
|
prefLabel |
salicylic acid |
|
subClassOf |