loading...| Preferred Name | leucine | |
| Synonyms |
Leuzin Hleu C6H13NO2 L (+-)-Leucine DL-Leucine InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) InChIKey=ROHFNLRQFUQHCH-UHFFFAOYSA-N (RS)-Leucine Leu CC(C)CC(N)C(O)=O 2-amino-4-methylpentanoic acid Leucin leucine |
|
| Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25017 |
|
| database_cross_reference |
ChemIDplus:328-39-2 Gmelin:50203 CiteXplore:17439666 Wikipedia:Leucine NIST Chemistry WebBook:328-39-2 Beilstein:636005 LIPID MAPS:LMFA01100048 Reaxys:636005 |
|
| definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
|
| has_exact_synonym |
leucine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Leuzin Hleu C6H13NO2 L (+-)-Leucine DL-Leucine InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) InChIKey=ROHFNLRQFUQHCH-UHFFFAOYSA-N (RS)-Leucine Leu CC(C)CC(N)C(O)=O 2-amino-4-methylpentanoic acid Leucin |
|
| id |
CHEBI:25017 |
|
| imported from | ||
| label |
leucine |
|
| notation |
CHEBI:25017 |
|
| prefLabel |
leucine |
|
| subClassOf |