loading...| Preferred Name | asparagine | |
| Synonyms |
Asn C4H8N2O3 2,4-diamino-4-oxobutanoic acid NC(CC(N)=O)C(O)=O InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) N ASN Asparagin asparagina 2-amino-3-carbamoylpropanoic acid DL-Asparagine InChIKey=DCXYFEDJOCDNAF-UHFFFAOYSA-N Hasp asparagine |
|
| Definitions |
An alpha-amino acid in which one of the hydrogens attached to the alpha-carbon of glycine is substituted by a 2-amino-2-oxoethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_22653 |
|
| database_cross_reference |
Gmelin:279043 Beilstein:1723525 CiteXplore:22264337 KEGG COMPOUND:C16438 CiteXplore:22770225 ChemIDplus:3130-87-8 Reaxys:1723525 Wikipedia:Asparagine |
|
| definition |
An alpha-amino acid in which one of the hydrogens attached to the alpha-carbon of glycine is substituted by a 2-amino-2-oxoethyl group. |
|
| has_exact_synonym |
asparagine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Asn C4H8N2O3 2,4-diamino-4-oxobutanoic acid NC(CC(N)=O)C(O)=O InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) N ASN Asparagin asparagina 2-amino-3-carbamoylpropanoic acid DL-Asparagine InChIKey=DCXYFEDJOCDNAF-UHFFFAOYSA-N Hasp |
|
| id |
CHEBI:22653 |
|
| imported from | ||
| label |
asparagine |
|
| notation |
CHEBI:22653 |
|
| prefLabel |
asparagine |
|
| subClassOf |