loading...| Preferred Name | L-ornithine | |
| Synonyms |
(S)-2,5-Diaminopentanoic acid InChIKey=AHLPHDHHMVZTML-BYPYZUCNSA-N (S)-2,5-Diaminopentanoate (S)-2,5-diaminovaleric acid NCCC[C@H](N)C(O)=O C5H12N2O2 (S)-alpha,delta-diaminovaleric acid (S)-ornithine InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 L-Ornithine L-ornithine (2S)-2,5-diaminopentanoic acid |
|
| Definitions |
An optically active form of ornithine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15729 |
|
| database_cross_reference |
KEGG COMPOUND:70-26-8 CiteXplore:22133808 KEGG COMPOUND:C00077 Gmelin:327282 DrugBank:DB00129 Wikipedia:Ornithine Reaxys:1722298 KEGG DRUG:D08302 CiteXplore:19173225 ChemIDplus:1722298 CiteXplore:22387109 PDBeChem:ORN CiteXplore:19083482 ChemIDplus:70-26-8 HMDB:HMDB00214 CiteXplore:22735334 CiteXplore:22033378 MetaCyc:ORNITHINE CiteXplore:18676473 CiteXplore:17190852 CiteXplore:15576628 |
|
| definition |
An optically active form of ornithine having L-configuration. |
|
| has_alternative_id |
CHEBI:13148 CHEBI:21367 CHEBI:6280 |
|
| has_exact_synonym |
L-Ornithine L-ornithine (2S)-2,5-diaminopentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(S)-2,5-Diaminopentanoic acid InChIKey=AHLPHDHHMVZTML-BYPYZUCNSA-N (S)-2,5-Diaminopentanoate (S)-2,5-diaminovaleric acid NCCC[C@H](N)C(O)=O C5H12N2O2 (S)-alpha,delta-diaminovaleric acid (S)-ornithine InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
|
| id |
CHEBI:15729 |
|
| imported from | ||
| label |
L-ornithine |
|
| notation |
CHEBI:15729 |
|
| prefixIRI |
CHEBI:15729 |
|
| prefLabel |
L-ornithine |
|
| subClassOf |