loading...| Preferred Name | stavudine | |
| Synonyms |
3'-Deoxy-2'-thymidinene 1-(2,3-Dideoxy-beta-D-glycero-pent-2-enofuranosyl)thymine 2',3'-Didehydro-3'-deoxythimidine Sanilvudine STV d4T estavudina stavudine stavudinum 1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4(1H,3H)-dione Stavudine |
|
| Definitions |
A nucleoside analogue obtained by formal dehydration across positions 2 and 3 of thymidine. An inhibitor of HIV-1 reverse transcriptase |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63581 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2478 CAS:3056-17-5 Patent:EP334368 KEGG:D00445 LINCS:LSM-5983 Wikipedia:Stavudine Reaxys:618327 KEGG:C07312 DrugBank:DB00649 Patent:US5130421 |
|
| definition |
A nucleoside analogue obtained by formal dehydration across positions 2 and 3 of thymidine. An inhibitor of HIV-1 reverse transcriptase |
|
| formula |
C10H12N2O4 |
|
| has characteristic | ||
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:9253 |
|
| has_exact_synonym |
1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4(1H,3H)-dione Stavudine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3'-Deoxy-2'-thymidinene 1-(2,3-Dideoxy-beta-D-glycero-pent-2-enofuranosyl)thymine 2',3'-Didehydro-3'-deoxythimidine Sanilvudine STV d4T estavudina stavudine stavudinum |
|
| id |
CHEBI:63581 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H12N2O4/c1-6-4-12(10(15)11-9(6)14)8-3-2-7(5-13)16-8/h2-4,7-8,13H,5H2,1H3,(H,11,14,15)/t7-,8+/m0/s1 |
|
| inchikey |
XNKLLVCARDGLGL-JGVFFNPUSA-N |
|
| label |
stavudine |
|
| mass |
224.21330 |
|
| monoisotopicmass |
224.07971 |
|
| notation |
CHEBI:63581 |
|
| prefLabel |
stavudine |
|
| smiles |
Cc1cn([C@@H]2O[C@H](CO)C=C2)c(=O)[nH]c1=O |
|
| subClassOf |