Preferred Name |
naproxen |
|
Synonyms |
naproxen Naproxen (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid naproxeno (S)-2-(6-Methoxy-2-naphthyl)propanoic acid (+)-Naproxen (S)-(+)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-2-(Methoxy-2-naphthyl)-propionsaeure (S)-2-(6-Methoxy-2-naphthyl)propionic acid (S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid (+)-(S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid naproxenum naproxene (+)-(S)-Naproxen (+)-2-(6-Methoxy-2-naphthyl)propionic acid (S)-Naproxen (S)-(+)-Naproxen (+)-2-(Methoxy-2-naphthyl)-propionic acid |
|
Definitions |
A methoxynaphthalene that is 2-methoxynaphthalene substituted by a carboxy ethyl group at position 6. Naproxen is a non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7476 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Naproxen Patent:US4009197 KEGG:D00118 Drug_Central:1883 DrugBank:DB00788 PMID:18044350 CAS:22204-53-1 Beilstein:3591067 PMID:24478225 Patent:US3904682 PMID:9784154 LINCS:LSM-5689 HMDB:HMDB0001923 |
|
definition |
A methoxynaphthalene that is 2-methoxynaphthalene substituted by a carboxy ethyl group at position 6. Naproxen is a non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
|
formula |
C14H14O3 |
|
has_alternative_id |
CHEBI:603695 |
|
has_exact_synonym |
naproxen Naproxen (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
naproxeno (S)-2-(6-Methoxy-2-naphthyl)propanoic acid naproxen (+)-Naproxen (S)-(+)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-2-(Methoxy-2-naphthyl)-propionsaeure (S)-2-(6-Methoxy-2-naphthyl)propionic acid (S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid (+)-(S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid naproxenum naproxene (+)-(S)-Naproxen (+)-2-(6-Methoxy-2-naphthyl)propionic acid (S)-Naproxen (S)-(+)-Naproxen (+)-2-(Methoxy-2-naphthyl)-propionic acid |
|
id |
CHEBI:7476 |
|
in_subset | ||
inchi |
InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/t9-/m0/s1 |
|
inchikey |
CMWTZPSULFXXJA-VIFPVBQESA-N |
|
label |
naproxen |
|
mass |
230.25920 |
|
monoisotopicmass |
230.09429 |
|
notation |
CHEBI:7476 |
|
prefLabel |
naproxen |
|
smiles |
COc1ccc2cc(ccc2c1)[C@H](C)C(O)=O |
|
subClassOf |