Preferred Name |
sucrose |
|
Synonyms |
Sucrose sucrose beta-D-fructofuranosyl alpha-D-glucopyranoside SUCROSE sacarosa Sacharose table sugar Saccharose Cane sugar beta-D-Fruf-(2<->1)-alpha-D-Glcp White sugar 1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside |
|
Definitions |
A glycosyl glycoside formed by glucose and fructose units joined by an acetal oxygen bridge from hemiacetal of glucose to the hemiketal of the fructose. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17992 |
|
charge |
0 |
|
database_cross_reference |
PMID:16663947 PMID:13508893 PDBeChem:SUC PMID:22311778 PMID:17233733 PMID:16228482 PMID:16313996 KEGG:D00025 PMID:22404833 Drug_Central:4610 PMID:15845855 PMID:12706980 PMID:11093712 Gmelin:97695 PMID:19726178 PMID:11111003 PMID:15291457 PMID:17439666 PMID:19199566 CAS:57-50-1 PMID:21703290 KEGG:G00370 PMID:15792978 Reaxys:90825 MetaCyc:SUCROSE PMID:15660210 PMID:16304615 KNApSAcK:C00001151 DrugBank:DB02772 PMID:12065720 KEGG:D06533 PMID:16665852 PMID:22751876 PMID:18625236 Reaxys:1435311 PMID:22085755 PMID:17597061 Wikipedia:Sucrose PMID:16660545 KEGG:C00089 PMID:16525719 HMDB:HMDB0000258 Beilstein:90825 PMID:11021636 PMID:21972845 |
|
definition |
A glycosyl glycoside formed by glucose and fructose units joined by an acetal oxygen bridge from hemiacetal of glucose to the hemiketal of the fructose. |
|
formula |
C12H22O11 |
|
has_alternative_id |
CHEBI:45795 CHEBI:26812 CHEBI:9314 CHEBI:15128 |
|
has_exact_synonym |
Sucrose sucrose beta-D-fructofuranosyl alpha-D-glucopyranoside SUCROSE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
sacarosa Sacharose table sugar Saccharose Cane sugar beta-D-Fruf-(2<->1)-alpha-D-Glcp White sugar 1-alpha-D-Glucopyranosyl-2-beta-D-fructofuranoside |
|
id |
CHEBI:17992 |
|
in_subset | ||
inchi |
InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
|
inchikey |
CZMRCDWAGMRECN-UGDNZRGBSA-N |
|
label |
sucrose |
|
mass |
342.29650 |
|
monoisotopicmass |
342.11621 |
|
notation |
CHEBI:17992 |
|
prefLabel |
sucrose |
|
smiles |
OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
|
subClassOf |