Jump to:
loading...| Preferred Name | estradiol | |
| Synonyms |
oestradiol estra-1,3,5(10)-triene-3,17-diol |
|
| Definitions |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_23965 |
|
| bearer of | ||
| charge |
0 |
|
| formula |
C18H24O2 |
|
| has exact synonym |
estra-1,3,5(10)-triene-3,17-diol |
|
| has parent hydride | ||
| has role | ||
| hasAlternativeId |
CHEBI:42364 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
oestradiol |
|
| id |
CHEBI:23965 |
|
| inchi |
InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17?,18+/m1/s1 |
|
| inchikey |
VOXZDWNPVJITMN-WKUFJEKOSA-N |
|
| inSubset | ||
| label |
estradiol |
|
| mass |
272.38196 |
|
| monoisotopicmass |
272.17763 |
|
| notation |
CHEBI:23965 |
|
| prefLabel |
estradiol |
|
| smiles |
[H][C@]12CC[C@]3(C)C(O)CC[C@@]3([H])[C@]1([H])CCc1cc(O)ccc21 |
|
| textual definition |
A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
|
| xRef |
PMID:10696569 PMID:24084694 Wikipedia:Estradiol |
|
| subClassOf |
Create mapping