loading...| Preferred Name |
L-tryptophan |
|
| Synonyms |
W N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O (S)-tryptophan QIVBCDIJIAJPQS-VIFPVBQESA-N tryptophan 204.22526 L-beta-3-indolylalanine (S)-alpha-Amino-beta-(3-indolyl)-propionic acid (S)-alpha-amino-1H-indole-3-propanoic acid (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 C11H12N2O2 TRYPTOPHAN Trp L-(-)-tryptophan 0 204.090 Tryptophan L-tryptophan L-Tryptophan |
|
| Definitions |
The L-enantiomer of tryptophan. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16828 |
|
| database_cross_reference |
Wikipedia:Tryptophan PMID:17127472 Gmelin:51434 PMID:17177562 KEGG:D00020 Reaxys:86197 PMID:17690425 PMID:22071091 HMDB:HMDB00929 PMID:22415306 PMID:17826001 YMDB:YMDB00126 PMID:11750787 PMID:18949702 PMID:22415302 PMID:11888576 PMID:22402312 CAS:73-22-3 PMID:19896323 PMID:17430113 PMID:22299628 Beilstein:86197 KEGG:C00078 PMID:21856896 PMID:22162421 PMID:12830226 PMID:11395471 PDBeChem:TRP PMID:2917974 PMID:15206750 ECMDB:ECMDB00929 PMID:18234569 PMID:18419734 PMID:22386992 MetaCyc:TRP PMID:16934873 KNApSAcK:C00001396 PMID:12871129 PMID:16740930 Drug_Central:2780 DrugBank:DB00150 PMID:17585690 PMID:12766158 |
|
| definition |
The L-enantiomer of tryptophan. |
|
| has_alternative_id |
CHEBI:13178 CHEBI:184633 CHEBI:46225 CHEBI:45988 CHEBI:46086 CHEBI:46125 CHEBI:6310 CHEBI:21407 |
|
| has_exact_synonym |
L-tryptophan L-Tryptophan |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
W N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O (S)-tryptophan QIVBCDIJIAJPQS-VIFPVBQESA-N tryptophan 204.22526 L-beta-3-indolylalanine (S)-alpha-Amino-beta-(3-indolyl)-propionic acid (S)-alpha-amino-1H-indole-3-propanoic acid (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 C11H12N2O2 TRYPTOPHAN Trp L-(-)-tryptophan 0 204.090 Tryptophan |
|
| id |
CHEBI:16828 |
|
| imported from | ||
| in_subset | ||
| label |
L-tryptophan |
|
| notation |
CHEBI:16828 |
|
| prefixIRI |
CHEBI:16828 |
|
| prefLabel |
L-tryptophan |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.