loading...| Preferred Name | L-ornithine | |
| Synonyms |
AHLPHDHHMVZTML-BYPYZUCNSA-N (S)-2,5-Diaminopentanoic acid 132.16106 (S)-2,5-Diaminopentanoate (S)-2,5-diaminovaleric acid NCCC[C@H](N)C(O)=O 132.090 C5H12N2O2 0 (S)-alpha,delta-diaminovaleric acid (S)-ornithine InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 L-Ornithine L-ornithine (2S)-2,5-diaminopentanoic acid |
|
| Definitions |
An optically active form of ornithine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15729 |
|
| database_cross_reference |
PMID:19083482 KEGG:D08302 Gmelin:327282 KEGG:C00077 PMID:22387109 DrugBank:DB00129 CAS:70-26-8 Wikipedia:Ornithine Reaxys:1722298 PMID:22133808 PMID:18676473 PMID:22735334 Beilstein:1722298 PMID:22033378 PDBeChem:ORN PMID:19173225 PMID:17190852 HMDB:HMDB00214 KNApSAcK:C00001384 Drug_Central:3401 MetaCyc:ORNITHINE PMID:15576628 |
|
| definition |
An optically active form of ornithine having L-configuration. |
|
| has_alternative_id |
CHEBI:13148 CHEBI:21367 CHEBI:6280 |
|
| has_exact_synonym |
L-Ornithine L-ornithine (2S)-2,5-diaminopentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
AHLPHDHHMVZTML-BYPYZUCNSA-N (S)-2,5-Diaminopentanoic acid 132.16106 (S)-2,5-Diaminopentanoate (S)-2,5-diaminovaleric acid NCCC[C@H](N)C(O)=O 132.090 C5H12N2O2 0 (S)-alpha,delta-diaminovaleric acid (S)-ornithine InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
|
| id |
CHEBI:15729 |
|
| imported from | ||
| in_subset | ||
| label |
L-ornithine |
|
| notation |
CHEBI:15729 |
|
| prefixIRI |
CHEBI:15729 |
|
| prefLabel |
L-ornithine |
|
| subClassOf |