loading...| Preferred Name |
lamotrigine |
|
| Synonyms |
6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine 3,5-diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine lamotriginum lamotrigina lamotrigine Lamictal |
|
| Definitions |
A member of the class of 1,2,4-triazines in which the triazene skeleton is substituted by amino groups at positions 3 and 5, and by a 2,3-dichlorophenyl group at position 6. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6367 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-4104 PMID:21242744 PMID:19430925 HMDB:HMDB0014695 DrugBank:DB00555 PMID:20825390 Wikipedia:Lamotrigine CAS:84057-84-1 Reaxys:7589268 Drug_Central:1540 KEGG:D00354 |
|
| definition |
A member of the class of 1,2,4-triazines in which the triazene skeleton is substituted by amino groups at positions 3 and 5, and by a 2,3-dichlorophenyl group at position 6. |
|
| formula |
C9H7Cl2N5 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35477 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_76779 http://purl.obolibrary.org/obo/CHEBI_60798 http://purl.obolibrary.org/obo/CHEBI_38215 http://purl.obolibrary.org/obo/CHEBI_35623 http://purl.obolibrary.org/obo/CHEBI_35469 |
|
| has_exact_synonym |
6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3,5-diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine lamotriginum lamotrigina lamotrigine Lamictal |
|
| has_RxCUI |
28439 |
|
| id |
CHEBI:6367 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
|
| inchikey |
PYZRQGJRPPTADH-UHFFFAOYSA-N |
|
| label |
lamotrigine |
|
| mass |
256.09100 |
|
| monoisotopicmass |
255.00785 |
|
| notation |
CHEBI:6367 |
|
| prefLabel |
lamotrigine |
|
| smiles |
Nc1nnc(c(N)n1)-c1cccc(Cl)c1Cl |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_39410 |