Preferred Name |
Clofibrate |
|
Synonyms |
clofibratum alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester alpha-p-Chlorophenoxyisobutyryl ethyl ester Ethyl chlorophenoxyisobutyrate Ethyl 2-(p-chlorophenoxy)isobutyrate 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester Ethyl clofibrate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester Atromid-S ELPI EPIB Lipofacton Liprin clofibrate clofibrato ethyl 2-(4-chlorophenoxy)-2-methylpropanoate Clofibrate |
|
Definitions |
The ethyl ester of clofibric acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3750 |
|
alternative label |
clofibratum alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester alpha-p-Chlorophenoxyisobutyryl ethyl ester Ethyl chlorophenoxyisobutyrate Ethyl 2-(p-chlorophenoxy)isobutyrate 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester Ethyl clofibrate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester Atromid-S ELPI EPIB Lipofacton Liprin clofibrate clofibrato ethyl 2-(4-chlorophenoxy)-2-methylpropanoate Clofibrate |
|
charge |
0 |
|
database_cross_reference |
PMID:28485676 KEGG:D00279 PMID:33070841 PMID:33893992 PMID:29059162 DrugBank:DB00636 PMID:27354598 LINCS:LSM-2996 Wikipedia:Clofibrate Patent:GB860303 PMID:30642049 PMCID:PMC7258001 Beilstein:1913459 PMCID:PMC8265473 KEGG:C06916 PMID:28248971 Drug_Central:694 HMDB:HMDB0014774 Patent:US3262850 PMID:28779283 Chemspider:2694 CAS:637-07-0 PMID:26949064 PMID:28512725 PMID:23603800 |
|
definition |
The ethyl ester of clofibric acid. |
|
formula |
C12H15ClO3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_70782 |
|
has_exact_synonym |
ethyl 2-(4-chlorophenoxy)-2-methylpropanoate Clofibrate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
clofibratum alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester alpha-p-Chlorophenoxyisobutyryl ethyl ester Ethyl chlorophenoxyisobutyrate Ethyl 2-(p-chlorophenoxy)isobutyrate 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester Ethyl clofibrate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester Atromid-S ELPI EPIB Lipofacton Liprin clofibrate clofibrato |
|
has_RxCUI |
2594 |
|
id |
CHEBI:3750 |
|
in_subset | ||
inchi |
InChI=1S/C12H15ClO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 |
|
inchikey |
KNHUKKLJHYUCFP-UHFFFAOYSA-N |
|
label |
Clofibrate clofibrate |
|
mass |
242.69900 |
|
monoisotopicmass |
242.07097 |
|
notation |
CHEBI:3750 |
|
prefLabel |
Clofibrate |
|
smiles |
CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |