Preferred Name | L-arginine | |
Synonyms |
L-(+)-arginine (S)-2-amino-5-guanidinopentanoic acid (2S)-2-amino-5-(carbamimidamido)pentanoic acid (2S)-2-amino-5-guanidinopentanoic acid (S)-2-Amino-5-guanidinovaleric acid Arg L-Arg L-Arginin R arginine L-Arginine L-arginine |
|
Definitions |
An L-alpha-amino acid that is the L-isomer of arginine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16467 |
|
alternative label |
L-(+)-arginine (S)-2-amino-5-guanidinopentanoic acid (2S)-2-amino-5-(carbamimidamido)pentanoic acid (2S)-2-amino-5-guanidinopentanoic acid (S)-2-Amino-5-guanidinovaleric acid Arg L-Arg L-Arginin R arginine L-Arginine L-arginine |
|
charge |
0 |
|
database_cross_reference |
KNApSAcK:C00001340 PMID:17168727 KEGG:C00062 Reaxys:1725413 PMID:21814794 PMID:22243793 YMDB:YMDB00592 PMID:16056256 PMID:11139824 PMID:22652429 PMID:22626826 KEGG:D02982 PMID:10848923 Wikipedia:L-arginine PMID:8070089 PMID:16416365 PMID:11300497 PMID:22553931 CAS:74-79-3 PMID:17439666 MetaCyc:ARG PMID:19030957 ECMDB:ECMDB00517 Gmelin:83283 HMDB:HMDB0000517 PMID:22361732 PMID:22179117 DrugBank:DB00125 PMID:12812828 PMID:22709481 PMID:22667467 PMID:15465805 PMID:22251130 PMID:22428068 PDBeChem:ARG PMID:21600268 PMID:22425811 Drug_Central:1549 PMID:11898853 Beilstein:1725413 PMID:22439203 PMID:22619480 PMID:15016745 PDBeChem:GND |
|
definition |
An L-alpha-amino acid that is the L-isomer of arginine. |
|
formula |
C6H14N4O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 |
|
has_alternative_id |
CHEBI:42927 CHEBI:13077 CHEBI:21235 CHEBI:6185 |
|
has_exact_synonym |
L-Arginine L-arginine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
L-(+)-arginine (S)-2-amino-5-guanidinopentanoic acid (2S)-2-amino-5-(carbamimidamido)pentanoic acid (2S)-2-amino-5-guanidinopentanoic acid (S)-2-Amino-5-guanidinovaleric acid Arg L-Arg L-Arginin R arginine |
|
id |
CHEBI:16467 |
|
in_subset | ||
inchi |
InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 |
|
inchikey |
ODKSFYDXXFIFQN-BYPYZUCNSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
label |
L-arginine |
|
mass |
174.20100 |
|
monoisotopicmass |
174.11168 |
|
notation |
CHEBI:16467 |
|
prefLabel |
L-arginine |
|
smiles |
N[C@@H](CCCNC(N)=N)C(O)=O |
|
subClassOf |