Preferred Name |
lomefloxacin |
|
Synonyms |
1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid Lomefloxacino Lomefloxacine 1,4-Dihydro-6,8-difluoro-1-ethyl-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid lomefloxacin (+-)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid Lomefloxacinum LFLX |
|
Definitions |
A fluoroquinolone antibiotic, used (generally as the hydrochloride salt) to treat bacterial infections including bronchitis and urinary tract infections. It is also used to prevent urinary tract infections prior to surgery. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_116278 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5145 KEGG:C07078 PMID:11195849 Wikipedia:Lomefloxacin Beilstein:4210041 Patent:US4528287 Drug_Central:1594 PMID:3348607 PMID:3134843 PMID:3476021 Patent:DE3433924 KEGG:D02318 CAS:98079-51-7 DrugBank:DB00978 |
|
definition |
A fluoroquinolone antibiotic, used (generally as the hydrochloride salt) to treat bacterial infections including bronchitis and urinary tract infections. It is also used to prevent urinary tract infections prior to surgery. |
|
formula |
C17H19F2N3O3 |
|
has role | ||
has_alternative_id |
CHEBI:6517 |
|
has_exact_synonym |
1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Lomefloxacino Lomefloxacine 1,4-Dihydro-6,8-difluoro-1-ethyl-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid lomefloxacin (+-)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid Lomefloxacinum LFLX |
|
has_RxCUI |
28872 |
|
id |
CHEBI:116278 |
|
in_subset | ||
inchi |
InChI=1S/C17H19F2N3O3/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25) |
|
inchikey |
ZEKZLJVOYLTDKK-UHFFFAOYSA-N |
|
label |
lomefloxacin |
|
mass |
351.34790 |
|
monoisotopicmass |
351.13945 |
|
notation |
CHEBI:116278 |
|
prefLabel |
lomefloxacin |
|
smiles |
CCn1cc(C(O)=O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c12 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_87211 http://purl.obolibrary.org/obo/CHEBI_46848 http://purl.obolibrary.org/obo/CHEBI_23765 |