loading...| Preferred Name |
dextrothyroxine |
|
| Synonyms |
C15H11I4NO4 (2R)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00509 |
|
| activates | ||
| ATCCode |
H03AA01 C10AX01 |
|
| CASRN |
51-49-0 |
|
| DBBrand |
dynothel choloxin lisolipin eulipos |
|
| DBSynonym |
d-thyroxine |
|
| Definition |
The major hormone derived from the thyroid gland. Thyroxine is synthesized via the iodination of tyrosines (monoiodotyrosine) and the coupling of iodotyrosines (diiodotyrosine) in the thyroglobulin. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is peripherally deiodinated to form triiodothyronine which exerts a broad spectrum of stimulatory effects on cell metabolism. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m1/s1 |
|
| InChIKey |
InChIKey=XUIIKFGFIJCVMT-GFCCVEGCSA-N |
|
| label |
dextrothyroxine |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_4551 http://purl.obolibrary.org/obo/CHEBI_53766 http://purl.obolibrary.org/obo/CHEBI_133809 |
|
| prefixIRI |
obo2:dinto_DB00509 |
|
| prefLabel |
dextrothyroxine |
|
| related with |
http://purl.obolibrary.org/obo/dinto_1805 http://purl.obolibrary.org/obo/dinto_2129 http://purl.obolibrary.org/obo/dinto_0262 http://purl.obolibrary.org/obo/dinto_2019 |
|
| SMILES |
N[C@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O |
|
| Synonym |
C15H11I4NO4 (2R)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
|
| xref |
Wikipedia:http://en.wikipedia.org/wiki/Dextrothyroxine PharmGKB:PA164752444 Drugs Product Database (DPD):2170299 ChEBI:30659 |
|
| subClassOf |