loading...| Preferred Name | cycloleucine | |
| Synonyms |
C6H11NO2 1-aminocyclopentane-1-carboxylic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB04620 |
|
| binds | ||
| CASRN |
52-52-8 |
|
| DBSynonym |
amino-1-cyclopentanecarboxylic acid 1-amino-1-cyclopentanecarboxylic acid 1-aminocyclopentane-1-carboxylic acid 1-aminocyclopentanecarboxylic acid 1-amino-cyclopentanecarboxylic acid 1-aminocyclopentanecarboxylate cyclo-leucine cycloleucin |
|
| Definition |
Cycloleucine is an amino acid formed by cyclization of leucine. Cycloleucine is a non-metabolisable amino acid and is a specific and reversible inhibitor of nucleic acid methylation, and as such is widely used in biochemical experiments. [Wikipedia] |
|
| InChI |
InChI=1S/C6H11NO2/c7-6(5(8)9)3-1-2-4-6/h1-4,7H2,(H,8,9) |
|
| InChIKey |
InChIKey=NILQLFBWTXNUOE-UHFFFAOYSA-N |
|
| label |
cycloleucine |
|
| prefixIRI |
obo2:dinto_DB04620 |
|
| prefLabel |
cycloleucine |
|
| related with | ||
| SMILES |
NC1(CCCC1)C(O)=O |
|
| Synonym |
C6H11NO2 1-aminocyclopentane-1-carboxylic acid |
|
| xref |
PubChem Substance:46505671 PubChem Compound:2901 Wikipedia:http://en.wikipedia.org/wiki/Cycloleucine PDB:AC5 |
|
| subClassOf |