Preferred Name |
oxitriptan |
|
Synonyms |
C11H12N2O3 (2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
|
ID |
http://purl.obolibrary.org/obo/dinto_DB02959 |
|
ATCCode |
N06AX01 |
|
CASRN |
4350-09-8 |
|
DBBrand |
levothym |
|
DBSynonym |
5-hydroxy-l-tryptophan hydroxy-5 l-tryptophane |
|
Definition |
5-Hydroxytryptophan (5-HTP), also known as oxitriptan (INN), is a naturally occurring amino acid and chemical precursor as well as a metabolic intermediate in the biosynthesis of the neurotransmitters serotonin and melatonin from tryptophan. 5-HTP is sold over-the-counter in the United Kingdom, United States and Canada as a dietary supplement for use as an antidepressant, appetite suppressant, and sleep aid, and is also marketed in many European countries for the indication of major depression under trade names like Cincofarm, Levothym, Levotonine, Oxyfan, Telesol, Tript-OH, and Triptum. Several double-blind placebo-controlled clinical trials have demonstrated the effectiveness of 5-HTP in the treatment of depression, though a lack of high quality studies has been noted. More and larger studies are needed to determine if 5-HTP is truly effective in treating depression. |
|
InChI |
InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1 |
|
InChIKey |
InChIKey=LDCYZAJDBXYCGN-VIFPVBQESA-N |
|
label |
oxitriptan |
|
prefixIRI |
obo2:dinto_DB02959 |
|
prefLabel |
oxitriptan |
|
related with | ||
SMILES |
N[C@@H](CC1=CNC2=C1C=C(O)C=C2)C(O)=O |
|
Synonym |
C11H12N2O3 (2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
|
xref |
ChEBI:17780 PDB:HRP |
|
subClassOf |