loading...| Preferred Name |
pheniramine |
|
| Synonyms |
dimethyl[3-phenyl-3-(pyridin-2-yl)propyl]amine C16H20N2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01620 |
|
| ATCCode |
R06AB05 |
|
| binds | ||
| blocks | ||
| CASRN |
86-21-5 |
|
| DBBrand |
trimeton tripoton pyriton metron avil |
|
| DBSynonym |
feniramina [inn-spanish] feniramine pheniraminum [inn-latin] prophenpyridamine propheniramine |
|
| Definition |
One of the histamine H1 antagonists with little sedative action. It is used in treatment of hay fever, rhinitis, allergic dermatoses, and pruritus. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C16H20N2/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16/h3-10,12,15H,11,13H2,1-2H3 |
|
| InChIKey |
InChIKey=IJHNSHDBIRRJRN-UHFFFAOYSA-N |
|
| label |
pheniramine |
|
| modulates | ||
| prefixIRI |
obo2:dinto_DB01620 |
|
| prefLabel |
pheniramine |
|
| SMILES |
CN(C)CCC(C1=CC=CC=C1)C1=CC=CC=N1 |
|
| Synonym |
dimethyl[3-phenyl-3-(pyridin-2-yl)propyl]amine C16H20N2 |
|
| xref |
ChemSpider:4597 BindingDB:50017656 PharmGKB:PA164744506 PubChem Compound:4761 PubChem Substance:46505932 Wikipedia:http://en.wikipedia.org/wiki/Pheniramine |
|
| subClassOf |