loading...| Preferred Name |
ketazolam |
|
| Synonyms |
14-chloro-4,10-dimethyl-2-phenyl-3-oxa-7,10-diazatricyclo[9.4.0.0^{2,7}]pentadeca-1(11),4,12,14-tetraene-6,9-dione C20H17ClN2O3 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01587 |
|
| activates | ||
| ATCCode |
N05BA10 |
|
| CASRN |
27223-35-4 |
|
| Definition |
Ketazolam is a drug which is a benzodiazepine derivative. It possesses anxiolytic, anticonvulsant, sedative and skeletal muscle relaxant properties. Ketazolam is not approved for sale in the United States or Canada. |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_2875 http://purl.obolibrary.org/obo/dinto_0114 http://purl.obolibrary.org/obo/dinto_2745 http://purl.obolibrary.org/obo/dinto_1453 |
|
| InChI |
InChI=1S/C20H17ClN2O3/c1-13-10-18(24)23-12-19(25)22(2)17-9-8-15(21)11-16(17)20(23,26-13)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
|
| InChIKey |
InChIKey=PWAJCNITSBZRBL-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by | ||
| is transported by | ||
| label |
ketazolam |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_3699 |
|
| prefixIRI |
obo2:dinto_DB01587 |
|
| prefLabel |
ketazolam |
|
| related with |
http://purl.obolibrary.org/obo/dinto_2875 http://purl.obolibrary.org/obo/dinto_0114 http://purl.obolibrary.org/obo/dinto_1453 http://purl.obolibrary.org/obo/dinto_0109 |
|
| SMILES |
CN1C2=C(C=C(Cl)C=C2)C2(OC(C)=CC(=O)N2CC1=O)C1=CC=CC=C1 |
|
| Synonym |
14-chloro-4,10-dimethyl-2-phenyl-3-oxa-7,10-diazatricyclo[9.4.0.0^{2,7}]pentadeca-1(11),4,12,14-tetraene-6,9-dione C20H17ClN2O3 |
|
| xref |
ChemSpider:31110 PubChem Substance:46507008 PharmGKB:PA164749385 Wikipedia:http://en.wikipedia.org/wiki/Ketazolam PubChem Compound:33746 |
|
| subClassOf |