loading...| Preferred Name |
decitabine |
|
| Synonyms |
C8H12N4O4 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2-dihydro-1,3,5-triazin-2-one |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01262 |
|
| CASRN |
2353-33-5 |
|
| DBBrand |
dacogen |
|
| DBSynonym |
azadc dezocitidine 5-aza-2'-deoxycytidine |
|
| Definition |
Decitabine is indicated for treatment of patients with myelodysplastic syndrome (MDS). It is a chemical analogue of cytidine, a nucleoside present in DNA and RNA. Cells in the presence of Decitabine incorporate it into DNA during replication and RNA during transcription. The incorporation of Decitabine into DNA or RNA inhibits methyltransferase thereby causing demethylation in that sequence. This adversely affects the way that cell regulatory proteins are able to bind to the DNA/RNA substrate. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C8H12N4O4/c9-7-10-3-12(8(15)11-7)6-1-4(14)5(2-13)16-6/h3-6,13-14H,1-2H2,(H2,9,11,15)/t4-,5+,6+/m0/s1 |
|
| InChIKey |
InChIKey=XAUDJQYHKZQPEU-KVQBGUIXSA-N |
|
| inhibits | ||
| label |
decitabine |
|
| prefixIRI |
obo2:dinto_DB01262 |
|
| prefLabel |
decitabine |
|
| related with | ||
| SMILES |
NC1=NC(=O)N(C=N1)[C@H]1C[C@H](O)[C@@H](CO)O1 |
|
| Synonym |
C8H12N4O4 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2-dihydro-1,3,5-triazin-2-one |
|
| xref |
PubChem Compound:451668 Wikipedia:http://en.wikipedia.org/wiki/Decitabine Drugs.com:http://www.drugs.com/cdi/decitabine.html National Drug Code Directory:62856-600-01 ChEBI:50131 ChemSpider:397844 PubChem Substance:46505657 PharmGKB:PA164749631 |
|
| subClassOf |