loading...| Preferred Name | hyoscyamine | |
| Synonyms |
C17H23NO3 (1R,3S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl (2S)-3-hydroxy-2-phenylpropanoate |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00424 |
|
| AHFScode |
92:02.00* 12:08.08 |
|
| ATCCode |
A03BA03 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_3182 http://purl.obolibrary.org/obo/dinto_3887 |
|
| blocks |
http://purl.obolibrary.org/obo/dinto_3182 http://purl.obolibrary.org/obo/dinto_1005 |
|
| CASRN |
101-31-5 |
|
| DBBrand |
egacene cystospaz gastrosed buwecon oin neoquess levbid peptard symax scopolia extract egazil nulev levsin donnamar anaspaz levsinex |
|
| DBSynonym |
l-hyoscyamine (s)-(?)-hyoscyamine daturine l-hyoscamine l-atropine duboisine (?)-atropine l-hyopscyamine l-tropine tropate (s)-atropine hyocyamine (?)-hyoscyamine |
|
| Definition |
Hyoscyamine is a chemical compound, a tropane alkaloid it is the levo-isomer to atropine. It is a secondary metabolite of some plants, particularly henbane (Hyoscamus niger.) Hyoscyamine is used to provide symptomatic relief to various gastrointestinal disorders including spasms, peptic ulcers, irritable bowel syndrome, pancreatitis, colic and cystitis. It has also been used to relieve some heart problems, control some of the symptoms of Parkinson s disease, as well as for control of respiratory secretions in end of life care. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15+,16-/m1/s1 |
|
| InChIKey |
InChIKey=RKUNBYITZUJHSG-FXUDXRNXSA-N |
|
| label |
hyoscyamine |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_42944 http://purl.obolibrary.org/obo/dinto_DB00209 http://purl.obolibrary.org/obo/CHEBI_8874 http://purl.obolibrary.org/obo/CHEBI_5613 http://purl.obolibrary.org/obo/CHEBI_53289 http://purl.obolibrary.org/obo/dinto_DB00427 |
|
| modulates |
http://purl.obolibrary.org/obo/dinto_3182 http://purl.obolibrary.org/obo/dinto_1005 |
|
| prefixIRI |
obo2:dinto_DB00424 |
|
| prefLabel |
hyoscyamine |
|
| SMILES |
CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)[C@H](CO)C1=CC=CC=C1 |
|
| Synonym |
C17H23NO3 (1R,3S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl (2S)-3-hydroxy-2-phenylpropanoate |
|
| xref |
PharmGKB:PA164776844 Drugs.com:http://www.drugs.com/cdi/hyoscyamine.html ChEBI:17486 Wikipedia:http://en.wikipedia.org/wiki/Hyoscyamine RxList:http://www.rxlist.com/cgi/generic/hyoscy.htm Drugs Product Database (DPD):125857 |
|
| subClassOf |