loading...| Preferred Name | oxiconazole | |
| Synonyms |
C18H13Cl4N3O (E)-[1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethylidene][(2,4-dichlorophenyl)methoxy]amine |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00239 |
|
| ATCCode |
G01AF17 D01AC11 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_3072 http://purl.obolibrary.org/obo/dinto_2157 |
|
| CASRN |
64211-46-7 |
|
| DBBrand |
oxistat |
|
| DBSynonym |
oxiconazole nitrate oxiconazol [inn-spanish] oxiconazolum [inn-latin] |
|
| Definition |
Oxiconazole nitrate (U.S.: Oxistat, Canada: Oxizole) is an antifungal medication typically administered in a cream or lotion to treat skin infections such as athlete s foot, jock itch and ringworm. [Wikipedia] |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000905 http://purl.obolibrary.org/obo/OAE_0000373 http://purl.obolibrary.org/obo/OAE_0000687 http://purl.obolibrary.org/obo/OAE_0000086 http://purl.obolibrary.org/obo/OAE_0000645 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C18H13Cl4N3O/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22/h1-8,11H,9-10H2/b24-18- |
|
| InChIKey |
InChIKey=QRJJEGAJXVEBNE-MOHJPFBDSA-N |
|
| induces | ||
| inhibits | ||
| is metabolised by | ||
| is substrate of | ||
| label |
oxiconazole |
|
| prefixIRI |
obo2:dinto_DB00239 |
|
| prefLabel |
oxiconazole |
|
| SMILES |
ClC1=CC(Cl)=C(CO\N=C(\CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1 |
|
| Synonym |
C18H13Cl4N3O (E)-[1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethylidene][(2,4-dichlorophenyl)methoxy]amine |
|
| xref |
PubChem Compound:5361463 PubChem Substance:46504752 RxList:http://www.rxlist.com/cgi/generic3/oxico.htm Drugs Product Database (DPD):2230452 National Drug Code Directory:0173-0423-00 PDRhealth:http://www.pdrhealth.com/drug_info/rxdrugprofiles/drugs/oxi1314.shtml PharmGKB:PA164754742 Wikipedia:http://en.wikipedia.org/wiki/Oxiconazole ChemSpider:4514745 |
|
| subClassOf |