Preferred Name |
phenmetrazine |
|
Synonyms |
2-Phenyl-3-Methylmorpholine 3-methyl-2-phenylmorpholine C11H15NO |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8067 |
|
binds | ||
CASRN |
134-49-6 |
|
DBBrand |
psychamine a 66 hydrochloride mefolin cafilon neo-zine psychamine a 66 preludin marsin bromadryl probese-p hydrochloride preludin hydrochloride phenmetrazine hydrochloride probese-p phenmetrazin |
|
DBname |
phenmetrazine |
|
DBSynonym |
3-methyl-2-phenylmorpholine 2-phenyl-3-methylmorpholine phenmetraline hydrochloride fenmetrazin dexphenmetrazine oxazimedrine phenmetrazinum [inn-latin] usaf ge-1 fenmetrazina [inn-spanish] defenmetrazin |
|
Definition |
A member of the class of morpholines that is morpholine substituted with a phenyl group at position 2 and a methyl group at position 3. |
|
has pharmacological target | ||
has role | ||
InChI |
InChI=1S/C11H15NO/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3 |
|
InChIKey |
InChIKey=OOBHFESNSZDWIU-UHFFFAOYSA-N |
|
inhibits | ||
label |
phenmetrazine |
|
prefixIRI |
obo2:CHEBI_8067 |
|
prefLabel |
phenmetrazine |
|
SMILES |
CC1NCCOC1C1=CC=CC=C1 CC1NCCOC1c1ccccc1 |
|
Synonym |
2-Phenyl-3-Methylmorpholine 3-methyl-2-phenylmorpholine C11H15NO |
|
xref |
ChemSpider:4598 HMDB:HMDB14968 PubChem Substance:46504524 Wikipedia:http://en.wikipedia.org/wiki/Phenmetrazine CiteXplore:23211394 CiteXplore:14196928 CASRN:134-49-6 PharmGKB:PA164747188 Reaxys:140490 ChEMBL:775159 KEGG COMPOUND:C07432 PubChem Compound:4762 Wikipedia:Phenmetrazine CiteXplore:5356063 CiteXplore:4125018 DrugBank:DB00830 |
|
subClassOf |