Preferred Name |
dextromethorphan |
|
Synonyms |
Dextromethorphan 3-methoxy-17-methylmorphinan C18H25NO delta-Methorphan [H][C@@]12CCCC[C@@]11CCN(C)[C@@H]2Cc2ccc(OC)cc12 DXM 271.194 d-Methorphan MKXZASYAUGDDCJ-CGTJXYLNSA-N 271.39724 0 InChI=1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m0/s1 |
|
Definitions |
An organic heterotetracyclic compound that is morphinan substituted by a methoxy group at position 3 and a methyl group at position 7. It is used as an antitussive drug for suppressing cough. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4470 |
|
database_cross_reference |
CAS:125-71-3 Wikipedia:Dextromethorphan Reaxys:88549 PMID:24269965 PMID:18198471 KEGG:C06947 PMID:17461892 DrugBank:DB00514 KEGG:D03742 HMDB:HMDB01920 |
|
has_exact_synonym |
Dextromethorphan 3-methoxy-17-methylmorphinan |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
C18H25NO delta-Methorphan [H][C@@]12CCCC[C@@]11CCN(C)[C@@H]2Cc2ccc(OC)cc12 DXM 271.194 d-Methorphan MKXZASYAUGDDCJ-CGTJXYLNSA-N 271.39724 0 InChI=1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m0/s1 |
|
id |
CHEBI:4470 |
|
imported from | ||
in_subset | ||
label |
dextromethorphan |
|
notation |
CHEBI:4470 |
|
prefLabel |
dextromethorphan |
|
textual definition |
An organic heterotetracyclic compound that is morphinan substituted by a methoxy group at position 3 and a methyl group at position 7. It is used as an antitussive drug for suppressing cough. |
|
subClassOf |