loading...| Preferred Name | remifentanil | |
| Synonyms |
remifentanil REMIFENTANIL methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate Remifentanil |
|
| Definitions |
A piperidinecarboxylate ester that is methyl piperidine-4-carboxylate in which the hydrogen attached to the nitrogen is substituted by a 3-methoxy-3-oxopropyl group and the hydrogen at position 4 is substituted the nitrogen of N-propanoylaniline. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8802 |
|
| alternative label |
remifentanil REMIFENTANIL methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate Remifentanil |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D08473 CAS:132875-61-7 KEGG:C08021 Patent:US5019583 DrugBank:DB00899 Reaxys:4358750 Wikipedia:Remifentanil Patent:EP383579 Drug_Central:2363 HMDB:HMDB0015036 |
|
| definition |
A piperidinecarboxylate ester that is methyl piperidine-4-carboxylate in which the hydrogen attached to the nitrogen is substituted by a 3-methoxy-3-oxopropyl group and the hydrogen at position 4 is substituted the nitrogen of N-propanoylaniline. |
|
| formula |
C20H28N2O5 |
|
| has exact synonym |
REMIFENTANIL methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate Remifentanil |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_55322 |
|
| has_alternative_id |
CHEBI:211871 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
remifentanil |
|
| has_RxCUI |
73032 |
|
| id |
CHEBI:8802 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H28N2O5/c1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2/h5-9H,4,10-15H2,1-3H3 |
|
| inchikey |
ZTVQQQVZCWLTDF-UHFFFAOYSA-N |
|
| is_bearer_of |
http://purl.obolibrary.org/obo/DRON_00000041 |
|
| label |
remifentanil |
|
| mass |
376.44670 |
|
| monoisotopicmass |
376.19982 |
|
| notation |
CHEBI:8802 |
|
| prefLabel |
remifentanil |
|
| smiles |
CCC(=O)N(c1ccccc1)C1(CCN(CCC(=O)OC)CC1)C(=O)OC |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46874 http://purl.obolibrary.org/obo/CHEBI_13248 |