loading...| Preferred Name | chlorothiazide | |
| Synonyms |
chlorothiazide 6-chloro-7-sulfamoyl-2H-1,2,4-benzothiadiazine 1,1-dioxide chlorothiazidum 6-Chloro-1,1-dioxo-1,2-dihydro-1lambda*6*-benzo[1,2,4]thiadiazine-7-sulfonic acid amide clorotiazida Chlorothiazide 6-chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
| Definitions |
4H-1,2,4-benzothiadiazine 1,1-dioxide in which the hydrogen at position is substituted by chlorine and that at position 7 is substituted by a sulfonamide group. A diuretic, it is used for treatment of oedema and hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3640 |
|
| alternative_term |
Chlorothiazide 6-chloro-4H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Chlorothiazide CAS:58-94-6 DrugBank:DB00880 PMID:3712385 Beilstein:1084805 Drug_Central:609 Patent:US2809194 PMID:2160536 PMID:10891117 KEGG:C07461 PMID:28166217 KEGG:D00519 LINCS:LSM-5942 PMID:29438107 |
|
| definition |
4H-1,2,4-benzothiadiazine 1,1-dioxide in which the hydrogen at position is substituted by chlorine and that at position 7 is substituted by a sulfonamide group. A diuretic, it is used for treatment of oedema and hypertension. |
|
| DrugsinVirtualScreening |
true |
|
| formula |
C7H6ClN3O4S2 |
|
| fromArticle |
true |
|
| has_alternative_id |
CHEBI:162615 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
chlorothiazide 6-chloro-7-sulfamoyl-2H-1,2,4-benzothiadiazine 1,1-dioxide chlorothiazidum 6-Chloro-1,1-dioxo-1,2-dihydro-1lambda*6*-benzo[1,2,4]thiadiazine-7-sulfonic acid amide clorotiazida |
|
| id |
CHEBI:3640 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C7H6ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-3H,(H,10,11)(H2,9,12,13) |
|
| inchikey |
JBMKAUGHUNFTOL-UHFFFAOYSA-N |
|
| label |
chlorothiazide |
|
| mass |
295.72300 |
|
| monoisotopicmass |
294.94883 |
|
| notation |
CHEBI:3640 |
|
| preferred label |
chlorothiazide |
|
| prefLabel |
chlorothiazide |
|
| see also | ||
| smiles |
NS(=O)(=O)c1cc2c(NC=NS2(=O)=O)cc1Cl |
|
| textual definition |
4H-1,2,4-benzothiadiazine 1,1-dioxide in which the hydrogen at position is substituted by chlorine and that at position 7 is substituted by a sulfonamide group. A diuretic, it is used for treatment of oedema and hypertension. |
|
| subClassOf |