loading...| Preferred Name | arginine | |
| Synonyms |
2-amino-5-(carbamimidamido)pentanoic acid 2-Amino-5-guanidinovaleric acid 2-amino-5-guanidinopentanoic acid Arginin Harg Arginine arginine |
|
| Definitions |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29016 |
|
| alternative term |
2-amino-5-(carbamimidamido)pentanoic acid 2-Amino-5-guanidinovaleric acid 2-amino-5-guanidinopentanoic acid Arginin Harg Arginine arginine |
|
| charge |
0 |
|
| database_cross_reference |
CAS:7200-25-1 PMID:10848923 KEGG:C02385 Reaxys:1725411 Wikipedia:L-Arginine Beilstein:1725411 |
|
| formula |
C6H14N4O2 |
|
| has exact synonym |
Arginine arginine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:22616 CHEBI:2643 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-amino-5-(carbamimidamido)pentanoic acid 2-Amino-5-guanidinovaleric acid 2-amino-5-guanidinopentanoic acid Arginin Harg |
|
| id |
CHEBI:29016 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
|
| inchikey |
ODKSFYDXXFIFQN-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
arginine |
|
| mass |
174.20112 |
|
| monoisotopicmass |
174.11168 |
|
| notation |
CHEBI:29016 |
|
| prefLabel |
arginine |
|
| smiles |
NC(CCCNC(N)=N)C(O)=O |
|
| textual definition |
An alpha-amino acid that is glycine in which the alpha-is substituted by a 3-guanidinopropyl group. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24436 |