loading...| Preferred Name |
anthralin |
|
| Synonyms |
1,8-dihydroxyanthracen-9(10H)-one Anthralin dithranol 1,8-dihydroxy-9(10H)-anthracenone 1,8-dihydroxy-9-anthrone 1,8-dihydroxyanthrone |
|
| Definitions |
An anthracene compound derived by the substitution of -OH groups for hydrogen at C-1 and C-8, and with an oxo group at C-9. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_37510 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22335232 PMID:23079823 PMID:22370944 PMID:1640019 PMID:22931516 LINCS:LSM-6530 PMID:23488784 Wikipedia:Dithranol PMID:23088318 KEGG:D00233 CAS:1143-38-0 KEGG:C06831 Beilstein:2054360 Reaxys:2054360 PMID:23594093 Drug_Central:226 |
|
| definition |
An anthracene compound derived by the substitution of -OH groups for hydrogen at C-1 and C-8, and with an oxo group at C-9. |
|
| formula |
C14H10O3 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
1,8-dihydroxyanthracen-9(10H)-one Anthralin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dithranol 1,8-dihydroxy-9(10H)-anthracenone 1,8-dihydroxy-9-anthrone 1,8-dihydroxyanthrone |
|
| id |
CHEBI:37510 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 |
|
| inchikey |
NUZWLKWWNNJHPT-UHFFFAOYSA-N |
|
| is tautomer of | ||
| label |
anthralin |
|
| mass |
226.22740 |
|
| monoisotopicmass |
226.06299 |
|
| notation |
CHEBI:37510 |
|
| prefLabel |
anthralin |
|
| smiles |
Oc1cccc2Cc3cccc(O)c3C(=O)c12 |
|
| treeView | ||
| subClassOf |