loading...| Preferred Name |
acyclovir |
|
| Synonyms |
2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one Zovir acycloguanosine aciclovirum aciclovir |
|
| Definitions |
An oxopurine that is guanine substituted by a (2-hydroxyethoxy)methyl substituent at position 9. Used in the treatment of viral infections. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2453 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:DE2539963 LINCS:LSM-5459 PMID:28166217 Drug_Central:85 Wikipedia:Acyclovir PMID:11687127 PMID:24346595 PMID:26024233 PMID:8308511 Beilstein:1219402 CAS:59277-89-3 KEGG:C06810 PMID:11994034 Reaxys:1219402 Patent:US4199574 HMDB:HMDB0014925 KEGG:D00222 DrugBank:DB00787 PDBeChem:AC2 |
|
| definition |
An oxopurine that is guanine substituted by a (2-hydroxyethoxy)methyl substituent at position 9. Used in the treatment of viral infections. |
|
| formula |
C8H11N5O3 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:40459 |
|
| has_exact_synonym |
2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Zovir acycloguanosine aciclovirum aciclovir |
|
| id |
CHEBI:2453 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
|
| inchikey |
MKUXAQIIEYXACX-UHFFFAOYSA-N |
|
| label |
acyclovir |
|
| mass |
225.20460 |
|
| monoisotopicmass |
225.08619 |
|
| notation |
CHEBI:2453 |
|
| prefLabel |
acyclovir |
|
| smiles |
Nc1nc2n(COCCO)cnc2c(=O)[nH]1 |
|
| treeView | ||
| subClassOf |