Preferred Name |
tyramine |
|
Synonyms |
Tyramine 4-(2-aminoethyl)phenol 4-hydroxyphenethylamine 4-Hydroxyphenylethylamine p-(2-Aminoethyl)phenol p-hydroxyphenylethylamine p-(2-aminoethyl)phenol 2-(p-Hydroxyphenyl)ethylamine p-hydroxyphenethylamine Tyramin 4-Hydroxy-beta-phenylethylamine beta-(4-Hydroxyphenyl)ethylamine p-tyramine |
|
Definitions |
A primary amino compound obtained by formal decarboxylation of the amino acid tyrosine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15760 |
|
charge |
0 |
|
database_cross_reference |
PMID:6501508 MetaCyc:TYRAMINE PMID:15000446 LINCS:LSM-19016 Beilstein:1099914 PMID:319927 PMID:3137238 PMID:12707242 PMID:19137318 PMID:9282832 PMID:12183041 PMID:21628600 PMID:12811595 Gmelin:82946 KNApSAcK:C00001435 PMID:18422653 Wikipedia:Tyramine CAS:51-67-2 PDBeChem:AEF PMID:21570963 PMID:15932098 KEGG:C00483 PMID:21651557 PMID:15848803 PMID:11919655 PMID:22735334 HMDB:HMDB0000306 PMID:11361052 Drug_Central:2784 PMID:21909937 PMID:19189084 PMID:18970430 Reaxys:1099914 PMID:21850574 PMID:9731223 PMID:21679153 |
|
definition |
A primary amino compound obtained by formal decarboxylation of the amino acid tyrosine. |
|
formula |
C8H11NO |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_37733 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:27174 CHEBI:9799 CHEBI:15276 |
|
has_exact_synonym |
Tyramine 4-(2-aminoethyl)phenol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-hydroxyphenethylamine 4-Hydroxyphenylethylamine p-(2-Aminoethyl)phenol p-hydroxyphenylethylamine p-(2-aminoethyl)phenol 2-(p-Hydroxyphenyl)ethylamine p-hydroxyphenethylamine Tyramin 4-Hydroxy-beta-phenylethylamine beta-(4-Hydroxyphenyl)ethylamine p-tyramine |
|
id |
CHEBI:15760 |
|
in_subset | ||
inchi |
InChI=1S/C8H11NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6,9H2 |
|
inchikey |
DZGWFCGJZKJUFP-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
tyramine |
|
mass |
137.17900 |
|
monoisotopicmass |
137.08406 |
|
notation |
CHEBI:15760 |
|
prefLabel |
tyramine |
|
smiles |
NCCc1ccc(O)cc1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_50994 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50994 |