Preferred Name |
potassium carbonate |
|
Synonyms |
dipotassium carbonate Potassium carbonate, anhydrous Carbonic acid, dipotassium salt Kaliumcarbonat Carbonate of potash K2CO3 |
|
Definitions |
A potassium salt that is the dipotassium salt of carbonic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_131526 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Potassium_carbonate CAS:584-08-7 PMID:26810599 PMID:26656574 Reaxys:4267587 KEGG:D02038 PMID:26848047 PMID:26638140 |
|
definition |
A potassium salt that is the dipotassium salt of carbonic acid. |
|
formula |
CK2O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_33287 |
|
has_exact_synonym |
dipotassium carbonate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Potassium carbonate, anhydrous Carbonic acid, dipotassium salt Kaliumcarbonat Carbonate of potash K2CO3 |
|
id |
CHEBI:131526 |
|
in_subset | ||
inchi |
InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
|
inchikey |
BWHMMNNQKKPAPP-UHFFFAOYSA-L |
|
label |
potassium carbonate |
|
mass |
138.206 |
|
monoisotopicmass |
137.91216 |
|
notation |
CHEBI:131526 |
|
prefLabel |
potassium carbonate |
|
smiles |
[O-]C([O-])=O.[K+].[K+] |
|
treeView | ||
subClassOf |