loading...| Preferred Name | tamsulosin | |
| Synonyms |
(-)-tamsulosin tamsulosinum tamsulosine tamsulosina (R)-(-)-tamsulosin tamsulosin (R)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide Tamsulosin 5-[(2R)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide |
|
| Definitions |
A 5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide that has (R)-configuration. A specific alpha1 adrenoceptor antagonist used (generally as its hydrochloride salt, tamsulosin hydrochloride) in the treatment of prostatic hyperplasia, chronic prostatitis, urinary retention, and help with the passage of kidney stones. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9398 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Tamsulosin KEGG:D08560 Patent:US4703063 KEGG:C07124 DrugBank:DB00706 PMID:29737501 Patent:EP34432 Reaxys:6896059 Drug_Central:2562 PMID:2891044 PMID:30360332 PMID:30174141 CAS:106133-20-4 PMID:29971698 PMID:29913020 PMID:29974124 PMID:29728928 |
|
| definition |
A 5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide that has (R)-configuration. A specific alpha1 adrenoceptor antagonist used (generally as its hydrochloride salt, tamsulosin hydrochloride) in the treatment of prostatic hyperplasia, chronic prostatitis, urinary retention, and help with the passage of kidney stones. |
|
| formula |
C20H28N2O5S |
|
| has role | ||
| has_exact_synonym |
Tamsulosin 5-[(2R)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(-)-tamsulosin tamsulosinum tamsulosine tamsulosina (R)-(-)-tamsulosin tamsulosin (R)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide |
|
| id |
CHEBI:9398 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m1/s1 |
|
| inchikey |
DRHKJLXJIQTDTD-OAHLLOKOSA-N |
|
| is conjugate base of | ||
| is enantiomer of | ||
| label |
tamsulosin |
|
| mass |
408.514 |
|
| monoisotopicmass |
408.17189 |
|
| notation |
CHEBI:9398 |
|
| prefLabel |
tamsulosin |
|
| smiles |
C=1C=C(OCCN[C@@H](CC2=CC=C(C(=C2)S(N)(=O)=O)OC)C)C(=CC1)OCC |
|
| treeView | ||
| subClassOf |