Jump to:
loading...| Preferred Name | chromone | |
| Synonyms |
1-benzopyran-4-one 4-chromone 1,4-benzopyrone Benzo-gamma-pyrone 4-oxo-4H-1-benzopyran 4H-chromen-4-one |
|
| Definitions |
The simplest member of the class of chromones that is 4H-chromene with an oxo group at position 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_72013 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:114087 HMDB:HMDB0032938 Wikipedia:Chromone CAS:491-38-3 |
|
| definition |
The simplest member of the class of chromones that is 4H-chromene with an oxo group at position 4. |
|
| formula |
C9H6O2 |
|
| has_exact_synonym |
4H-chromen-4-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-benzopyran-4-one 4-chromone 1,4-benzopyrone Benzo-gamma-pyrone 4-oxo-4H-1-benzopyran |
|
| id |
CHEBI:72013 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H6O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H |
|
| inchikey |
OTAFHZMPRISVEM-UHFFFAOYSA-N |
|
| label |
chromone |
|
| mass |
146.14270 |
|
| monoisotopicmass |
146.03678 |
|
| notation |
CHEBI:72013 |
|
| prefLabel |
chromone |
|
| smiles |
O=c1ccoc2ccccc12 |
|
| treeView | ||
| subClassOf |
Create mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_72013 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_23238 | BIOMODELS | LOOM | |
| http://purl.jp/bio/4/id/200906029623253273 | IOBC | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_72013 | BERO | LOOM | |
| http://stirdf.jst.go.jp/id/200907002705201083 | IOBC | LOOM |