loading...| Preferred Name | demeclocycline | |
| Synonyms |
DMCT demeclocycline demeclocyclinum 7-chloro-6-demethyltetracycline [4S-(4alpha,4aalpha,5aalpha,6beta,12aalpha)]-7-chloro-4-(dimethylamino)1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-2-naphthacenecarboxamide demeclociclina DMCTC demethylchlortetracycline 6-demethyl-7-chlorotetracycline Demeclocycline (4S,4aS,5aS,6S,12aS)-7-chloro-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
|
| Definitions |
Tetracycline which lacks the methyl substituent at position 7 and in which the hydrogen para- to the phenolic hydroxy group is substituted by chlorine. Like tetracycline, it is an antibiotic, but being excreted more slowly, effective blood levels are maintained for longer. It is used (mainly as the hydrochloride) for the treatment of Lyme disease, acne and bronchitis, as well as for hyponatraemia (low blood sodium concentration) due to the syndrome of inappropriate antidiuretic hormone (SIADH) where fluid restriction alone has been ineffective. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4392 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Demeclocycline KEGG:D03680 DrugBank:DB00618 Patent:US2878289 Patent:FR1344645 Drug_Central:802 PMID:24134630 KEGG:D00290 CAS:127-33-3 Patent:US3019172 Patent:US3154476 Chemspider:10482117 Beilstein:2230579 Patent:US3012946 Patent:US3050446 |
|
| definition |
Tetracycline which lacks the methyl substituent at position 7 and in which the hydrogen para- to the phenolic hydroxy group is substituted by chlorine. Like tetracycline, it is an antibiotic, but being excreted more slowly, effective blood levels are maintained for longer. It is used (mainly as the hydrochloride) for the treatment of Lyme disease, acne and bronchitis, as well as for hyponatraemia (low blood sodium concentration) due to the syndrome of inappropriate antidiuretic hormone (SIADH) where fluid restriction alone has been ineffective. |
|
| formula |
C21H21ClN2O8 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_194423 |
|
| has_alternative_id |
CHEBI:554084 |
|
| has_exact_synonym |
Demeclocycline (4S,4aS,5aS,6S,12aS)-7-chloro-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DMCT demeclocycline demeclocyclinum 7-chloro-6-demethyltetracycline [4S-(4alpha,4aalpha,5aalpha,6beta,12aalpha)]-7-chloro-4-(dimethylamino)1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-2-naphthacenecarboxamide demeclociclina DMCTC demethylchlortetracycline 6-demethyl-7-chlorotetracycline |
|
| id |
CHEBI:4392 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-26,28-29,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14-,15-,21-/m0/s1 |
|
| inchikey |
FMTDIUIBLCQGJB-SEYHBJAFSA-N |
|
| label |
demeclocycline |
|
| mass |
464.85300 |
|
| monoisotopicmass |
464.09864 |
|
| notation |
CHEBI:4392 |
|
| prefLabel |
demeclocycline |
|
| smiles |
[H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@H]2O |
|
| treeView | ||
| subClassOf |