loading...| Preferred Name | ambenonium chloride | |
| Synonyms |
ambenonii chloridum N,N'-Bis(2-diethylaminoethyl)oxamide bis(2-chlorobenzyl chloride) (Oxalylbis(iminoethylene))bis((o-chlorobenzyl)diethylammonium) dichloride ambenonium chloride Ambenonium dichloride Chlorure d'ambenonium Ambestigmin chloride Cloruro de ambenonio 2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] dichloride |
|
| Definitions |
A symmetrical oxalamide-based bis-quaternary ammonium salt having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2628 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01122 CAS:115-79-7 Beilstein:7563564 Patent:DE1024517 KEGG:D01001 |
|
| definition |
A symmetrical oxalamide-based bis-quaternary ammonium salt having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
|
| formula |
C28H42Cl4N4O2 C28H42Cl2N4O2.2Cl |
|
| has role | ||
| has_exact_synonym |
2,2'-[(1,2-dioxoethane-1,2-diyl)diimino]bis[N-(2-chlorobenzyl)-N,N-diethylethanaminium] dichloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ambenonii chloridum N,N'-Bis(2-diethylaminoethyl)oxamide bis(2-chlorobenzyl chloride) (Oxalylbis(iminoethylene))bis((o-chlorobenzyl)diethylammonium) dichloride ambenonium chloride Ambenonium dichloride Chlorure d'ambenonium Ambestigmin chloride Cloruro de ambenonio |
|
| id |
CHEBI:2628 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H40Cl2N4O2.2ClH/c1-5-33(6-2,21-23-13-9-11-15-25(23)29)19-17-31-27(35)28(36)32-18-20-34(7-3,8-4)22-24-14-10-12-16-26(24)30;;/h9-16H,5-8,17-22H2,1-4H3;2*1H |
|
| inchikey |
DXUUXWKFVDVHIK-UHFFFAOYSA-N |
|
| label |
ambenonium chloride |
|
| mass |
608.47100 |
|
| monoisotopicmass |
606.20619 |
|
| notation |
CHEBI:2628 |
|
| prefLabel |
ambenonium chloride |
|
| smiles |
[Cl-].[Cl-].CC[N+](CC)(CCNC(=O)C(=O)NCC[N+](CC)(CC)Cc1ccccc1Cl)Cc1ccccc1Cl |
|
| treeView | ||
| subClassOf |