loading...| Preferred Name | thymidine | |
| Synonyms |
2'-thymidine 2'-deoxythymidine Deoxythymidine thymine 2'-deoxyriboside 5-methyl-2'-deoxyuridine T dThd 1-(2-deoxy-beta-D-erythro-pentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione 2'-deoxy-5-methyluridine THYMIDINE Thymidine thymidine |
|
| Definitions |
A pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17748 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Thymidine PMID:22770225 MetaCyc:THYMIDINE PMID:2559771 DrugBank:DB04485 Reaxys:89285 Gmelin:282610 CAS:50-89-5 HMDB:HMDB0000273 KEGG:C00214 KNApSAcK:C00019698 PDBeChem:THM |
|
| definition |
A pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase. |
|
| formula |
C10H14N2O5 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:9579 CHEBI:15244 CHEBI:45782 CHEBI:19273 CHEBI:45834 CHEBI:45917 |
|
| has_exact_synonym |
THYMIDINE Thymidine thymidine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2'-thymidine 2'-deoxythymidine Deoxythymidine thymine 2'-deoxyriboside 5-methyl-2'-deoxyuridine T dThd 1-(2-deoxy-beta-D-erythro-pentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione 2'-deoxy-5-methyluridine |
|
| id |
CHEBI:17748 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1 |
|
| inchikey |
IQFYYKKMVGJFEH-XLPZGREQSA-N |
|
| is enantiomer of | ||
| label |
thymidine |
|
| mass |
242.22860 |
|
| monoisotopicmass |
242.09027 |
|
| notation |
CHEBI:17748 |
|
| prefLabel |
thymidine |
|
| smiles |
Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O |
|
| treeView | ||
| subClassOf |