Link to this page
Chemical Entities of Biological Interest Ontology
| Preferred Name | prostaglandin E2 | |
| Synonyms |
Dinoproston dinoprostone Prostin E2 Cervidil Enzaprost E Prostarmon E dinoprostona dinoprostonum Prepidil PGE2 U 12062 (Z)-7-((1R,2R,3R)-3-hydroxy-2-((S,E)-3-hydroxyoct-1-enyl)-5-oxocyclopentyl)hept-5-enoic acid (5Z,11alpha,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid (15S)-prostaglandin E2 Minprostin E2 (E,Z)-(1R,2R,3R)-7-(3-Hydroxy-2-((3S)-(3-hydroxy-1-octenyl))-5-oxocyclopentyl)-5-heptenoic acid U-12062 Prostin Propess Glandin-E2 (5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate Minprositin E2 U-12,062 Cerviprost Cerviprime Prostenone (5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprosta-5,13-dienoate (5Z,13E,15S)-11alpha,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid Prostaglandin E2 |
|
| Definitions |
Prostaglandin F2alpha in which the hydroxy group at position 9 has been oxidised to the corresponding ketone. Prostaglandin E2 is the most common and most biologically potent of mammalian prostaglandins. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15551 |
|
| charge |
0
|
|
| database_cross_reference |
PMID:20671299 FooDB:FDB022498 PMID:11279302 PMID:9276764 PMID:24501112 Reaxys:2224724 Drug_Central:913 PMID:16405508 PMID:33685091 PMID:15661432 PMID:12746806 PMID:7836930 PMID:14499495 Patent:GB851827 PDBeChem:P2E PMID:32898608 PMID:14535055 HMDB:HMDB0001220 LINCS:LSM-42919 LIPID_MAPS_instance:LMFA03010003 PMID:14703707 KEGG:D00079 PMID:2403792 PMID:33958485 PMID:33559528 PMID:16978535 PMID:16787416 DrugBank:DB00917 PMID:33715333 KEGG:C00584 Beilstein:2224724 PMID:34065827 Wikipedia:Prostaglandin_E2 Patent:DE2011969 PMID:33782420 PMID:33271839 PMID:33811074 Patent:NL6505799 PMID:6317292 PMID:74611 CAS:363-24-6 PMID:34071686 PMID:7224729 PMID:12859290 Patent:US3598858 PMID:15542928 PMID:34102274
|
|
| definition |
Prostaglandin F2alpha in which the hydroxy group at position 9 has been oxidised to the corresponding ketone. Prostaglandin E2 is the most common and most biologically potent of mammalian prostaglandins.
|
|
| formula |
C20H32O5
|
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:8512 CHEBI:114125 CHEBI:26323 CHEBI:4625 CHEBI:10911 CHEBI:10910
|
|
| has_exact_synonym |
(5Z,13E,15S)-11alpha,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid Prostaglandin E2
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
Dinoproston dinoprostone Prostin E2 Cervidil Enzaprost E Prostarmon E dinoprostona dinoprostonum Prepidil PGE2 U 12062 (Z)-7-((1R,2R,3R)-3-hydroxy-2-((S,E)-3-hydroxyoct-1-enyl)-5-oxocyclopentyl)hept-5-enoic acid (5Z,11alpha,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid (15S)-prostaglandin E2 Minprostin E2 (E,Z)-(1R,2R,3R)-7-(3-Hydroxy-2-((3S)-(3-hydroxy-1-octenyl))-5-oxocyclopentyl)-5-heptenoic acid U-12062 Prostin Propess Glandin-E2 (5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate Minprositin E2 U-12,062 Cerviprost Cerviprime Prostenone (5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprosta-5,13-dienoate
|
|
| id |
CHEBI:15551
|
|
| in_subset | ||
| inchi |
InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,19+/m0/s1
|
|
| inchikey |
XEYBRNLFEZDVAW-ARSRFYASSA-N
|
|
| is conjugate acid of | ||
| label |
prostaglandin E2
|
|
| mass |
352.471
|
|
| monoisotopicmass |
352.22497
|
|
| notation |
CHEBI:15551
|
|
| prefLabel |
prostaglandin E2
|
|
| smiles |
CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O
|
|
| treeView | ||
| subClassOf |
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |