Jump to:
loading...| Preferred Name |
No preferred name provided for selected language
|
|
| Synonyms |
Fibrin |
|
| Definitions |
Further classification will be integrated for this class |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5054 |
|
| comment |
Further classification will be integrated for this class |
|
| charge |
0 |
|
| formula |
C5H11N3O2 |
|
| hasDbXref |
KEGG:C00290 CAS:9001-31-4 |
|
| hasExactSynonym |
Fibrin |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:5054 |
|
| inchi |
InChI=1S/C5H11N3O2/c1-7-5(10)3-8-4(9)2-6/h2-3,6H2,1H3,(H,7,10)(H,8,9) |
|
| inchikey |
BWGVNKXGVNDBDI-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
Fibrin Fibrin |
|
| mass |
145.160 |
|
| monoisotopicmass |
145.08513 |
|
| notation |
CHEBI:5054 |
|
| smiles |
CNC(=O)CNC(=O)CN |
|
| subClassOf |