Preferred Name |
No preferred name provided for selected language
|
|
Synonyms |
DL-Phenylalanine Phenylalanin alpha-Amino-beta-phenylpropionic acid fenilalanina F PHE 2-amino-3-phenylpropanoic acid Phenylalanine phenylalanine |
|
Definitions |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
|
charge |
0 |
|
definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
formula |
C9H11NO2 |
|
hasAlternativeId |
CHEBI:25984 CHEBI:8089 |
|
hasDbXref |
Reaxys:1910407 CAS:150-30-1 Gmelin:50836 PMID:17439666 PMID:22264337 Wikipedia:Phenylalanine KEGG:C02057 Beilstein:1910407 |
|
hasExactSynonym |
2-amino-3-phenylpropanoic acid Phenylalanine phenylalanine |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
DL-Phenylalanine Phenylalanin alpha-Amino-beta-phenylpropionic acid fenilalanina F PHE |
|
id |
CHEBI:28044 |
|
inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
|
inchikey |
COLNVLDHVKWLRT-UHFFFAOYSA-N |
|
inSubset | ||
label |
phenylalanine phenylalanine |
|
mass |
165.18918 |
|
monoisotopicmass |
165.07898 |
|
notation |
CHEBI:28044 |
|
smiles |
NC(Cc1ccccc1)C(O)=O |
|
subClassOf |