Preferred Name |
No preferred name provided for selected language
|
|
Synonyms |
2-amino-3-(1H-indol-3-yl)propanoic acid alpha-amino-beta-3-indolepropionic acid beta-3-indolylalanine alpha-Amino-beta-(3-indolyl)-propionic acid tryptophane Htrp Trp W triptofano Tryptophan tryptophan |
|
Definitions |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27897 |
|
charge |
0 |
|
definition |
An alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. |
|
formula |
C11H12N2O2 |
|
hasAlternativeId |
CHEBI:27163 CHEBI:9769 |
|
hasDbXref |
Wikipedia:Tryptophan Gmelin:4532 Reaxys:86196 PMID:17439666 PMID:22264337 CAS:54-12-6 Beilstein:86196 KEGG:C00806 KNApSAcK:C00001396 LINCS:LSM-36836 |
|
hasExactSynonym |
Tryptophan tryptophan |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
2-amino-3-(1H-indol-3-yl)propanoic acid alpha-amino-beta-3-indolepropionic acid beta-3-indolylalanine alpha-Amino-beta-(3-indolyl)-propionic acid tryptophane Htrp Trp W triptofano |
|
id |
CHEBI:27897 |
|
inchi |
InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
|
inchikey |
QIVBCDIJIAJPQS-UHFFFAOYSA-N |
|
inSubset | ||
label |
tryptophan tryptophan |
|
mass |
204.22526 |
|
monoisotopicmass |
204.08988 |
|
notation |
CHEBI:27897 |
|
smiles |
NC(Cc1c[nH]c2ccccc12)C(O)=O |
|
subClassOf |